Xem mã nguồn của Acid 4-hydroxy-3-nitrobenzenearsonic

{{Chembox
| name = Axit 4-hydroxy-3-nitrobenzenearsonic
| ImageFile = Roxarsone.png
| ImageSize = 120 px
| ImageName = Kekulé, skeletal formula of 4-hydroxy-3-nitrobenzenearsonic acid
| IUPACName = Axit 4-hydroxy-3-nitrobenzenearsonic{{fact|date = ngày 6 tháng 1 năm 2013}}
| OtherNames = Roxarsone
| Section1 = {{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 121-19-7
| PubChem = 5104
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
| ChemSpiderID = 4925
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 204-453-7
| UNNumber = 3465
| KEGG = D05771
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Roxarsone
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 35817
| RTECS = CY5250000
| Beilstein = 1976533
| Gmelin = 1221211
| SMILES = Oc1ccc(cc1-n(:o):o)[As](O)(O)=O
| SMILES1 = OC1=CC=C(C=C1[N+]([O-])=O)[As](O)(O)=O
| StdInChI = 1S/C6H6AsNO6/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,9H,(H2,10,11,12)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/C6H6AsNO6/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,9H,(H2,10,11,12)
| StdInChIKey = XMVJITFPVVRMHC-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = XMVJITFPVVRMHC-UHFFFAOYAF
}}
| Section2 = {{Chembox Properties
| Formula = {{Chem|C|6|AsNH|6|O|6}}
| MolarMass = 263.0365 g mol<sup>-1</sup>
| ExactMass = 262.941108346 g mol<sup>-1</sup>
| MeltingPt = >300 °C
}}
| Section3 = {{Chembox Hazards
| GHSPictograms = {{GHS skull and crossbones}} {{GHS environment}}
| GHSSignalWord = '''DANGER'''
| HPhrases = {{H-phrases|301|331|410}}
| PPhrases = {{P-phrases|261|273|301+310|311|501}}
| EUClass = {{Hazchem T}} {{Hazchem N}}
| RPhrases = {{R23/25}}, {{R50/53}}
| SPhrases = {{S20/21}}, {{S28}}, {{S45}}, {{S60}}, {{S61}}
}}
}}

'''Axit 4-hydroxy-3-nitrobenzenearsonic''' là [[hợp chất hữu cơ]] được sử dụng rộng rãi trong [[nông nghiệp]] để làm phụ gia thức ăn chăn nuôi [[gà]]. Đây là dẫn xuất của [[axit phenylarsonic]] (C<sub>6</sub>H<sub>5</sub>As(O)(OH)<sub>2</sub>). Hợp chất hữu cơ arsenic này có tên thương mại là Roxarsone, là nguồn gây nhiễm arsenic đáng lưu ý trong [[chuỗi thực phẩm]]. Năm 2006, khoảng 1000 tấn hợp chất này đã được sản xuất tại [[Hoa Kỳ|Mỹ]].<ref>{{chú thích báo | author = Hileman, B. | url = http://pubs.acs.org/cen/government/85/8515gov2.html | title = Arsenic in Chicken Production | publisher = [[Chemical and Engineering News]] | date = ngày 9 tháng 4 năm 2007 | pages = 34–35}}</ref> Hợp chất này được biết đến lần đầu tiên vào năm 1923 trong một sáng chế tại Anh mô tả quá trình nitrat hóa và diazo hóa của [[axit arsanilic]].<ref>GB 226255 19230718</ref> Hỗn hợp của roxarsone với bột calcit được dùng rộng rãi để sản xuất premix trong công nghiệp chăn nuôi gia cầm và thường bán sẵn ở các nồng độ 5%, 20% và 50%.

Tháng 6 năm 2011, Cơ quan Dược phẩm và Thực phẩm Hoa Kỳ ([[Cục quản lý Thực phẩm và Dược phẩm Hoa Kỳ|FDA]]) đã quy định cấm buôn bán sản phẩm này sau 30 ngày do FDA phát hiện mức arsenic (dù rất thấp) trong gan gà được cho ăn axit arsonic.<ref>{{chú thích báo | author = Cevallos, M. | url = http://www.latimes.com/health/boostershots/la-heb-arsenic-chicken-pfizer-20110608,0,6568583.story | title = Arsenic-containing drug in chicken feed to be pulled from Hoa Kỳ | publisher = [[Los Angeles Times|LA Times]] | date = ngày 9 tháng 6 năm 2011}}</ref>

==Chú thích==
{{Tham khảo}}

==Đọc thêm==
*{{chú thích tạp chí
| author = J. R. Garbarino, A. J. Bednar, D. W. Rutherford, R. S. Beyer, and R. L. Wershaw 
| title = Environmental Fate of Roxarsone in Poultry Litter. I. Degradation of Roxarsone during Composting
| journal = Environ. Sci. Technol. 
| year = 2003
| volume = 37
| issue = 8
| pages = 1509–1514
| doi = 10.1021/es026219q+S0013-936X(02)06219-3
| pmid = 12731831}}
*{{chú thích tạp chí
| author = Chiou P. W.-S.; Chen K.-L.; Yu B.| title = Effects of roxarsone on performance, toxicity, tissue accumulation and residue of eggs and excreta in laying
| journal = Journal of the science of food and agriculture
| year = 1997
| volume = 74
| issue = 2
| pages = 229–236
| doi = 10.1002/(SICI)1097-0010(199706)74:2<229::AID-JSFA793>3.0.CO;2-F}}
*{{chú thích tạp chí
| author = R. L. Wershaw, J. R. Garbarino, and M. R. Burkhardt
| title = Roxarsone in Natural Water Systems
| url = http://water.usgs.gov/owq/AFO/proceedings/afo/pdf/Wershaw.pdf}}
*{{chú thích tạp chí
| author = KB Kerr, JR Narveson, FA Lux
| title = Toxicity of an organic arsenical, 3-nitro-4-hydroxyphenylarsonic acid. Residues in chicken tissues
| journal = Journal of Agricultural and Food Chemistry 
| year = 1969
| volume = 17
| pages = 1400
| doi =10.1021/jf60166a021
| issue = 6 }}

==Liên kết ngoài==
*[http://www.npr.org/blogs/health/2010/11/24/131566322/no-arsenic-in-pardoned-turkeys-but-it-might-be-in-yours No Arsenic In Pardoned Turkeys, But It Might Be In Yours] at [[NPR]]

[[Thể loại:Acid arsonic]]
[[Thể loại:Lớp phenol]]
[[Thể loại:Nitrobenzen]]
[[Thể loại:Thức ăn chăn nuôi]]
[[Thể loại:An toàn thực phẩm]]