Xem mã nguồn của Clostebol caproate

{{Infobox drug
| IUPAC_name = (1''S'',2''R'',10''R'',11''S'',14''S'',15''S'')-6-Chloro-2,15-dimethyl-5-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-6-en-14-yl hexanoate
| image = Clostebol caproate.svg
| width = 250px
| image2 = Clostebol caproate molecule ball.png
| width2 = 250px

<!--Clinical data-->| tradename = Macrobin-Depot
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = [[Intramuscular injection]]

<!--Pharmacokinetic data-->| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = <!-- Identifiers -->
| CAS_number = 32361-10-7
| CAS_number_Ref = 
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 
| IUPHAR_ligand = 
| DrugBank = 
| DrugBank_Ref = 
| ChemSpiderID = 8246328
| ChemSpiderID_Ref = 
| UNII = 
| KEGG = 
| ChEBI = 
| ChEMBL = <!--Chemical data-->
| synonyms = 
| C = 25
| Cl = 1
| H = 37
| O = 3
| molecular_weight = 421.019 g/mol
| SMILES = CCCCCC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=C(Cl)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C
| StdInChI = 1S/C25H37ClO3/c1-4-5-6-7-22(28)29-21-11-10-17-16-8-9-19-23(26)20(27)13-15-24(19,2)18(16)12-14-25(17,21)3/h16-18,21H,4-15H2,1-3H3/t16-,17-,18-,21-,24?,25?/m0/s1
| StdInChIKey = OMNUNHQDARKLSM-VPKDWVKTSA-N
| StdInChIKey_Ref = 
| StdInChI_Ref = 
| verifiedrevid = 
}}
'''Clostebol caproate''' (biệt dược '''Macrobin-Depot'''), hay '''clostebol hexanoate''' hay '''chlorotestosterone caproate''' (JAN), và '''4-chlorotestosterone 17β-caproate''' hay '''4-chloroandrost-4-en-17β-ol-3-one 17β-caproate''', là một dẫn xuất tổng hợp, tiêm steroid đồng hóa-androgenic (AAS) của [[testosterone]].<ref name="Elks2014">{{Chú thích sách|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA305|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|last=J. Elks|date=ngày 14 tháng 11 năm 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=305–}}</ref><ref name="MortonHall1999">{{Chú thích sách|url=https://books.google.com/books?id=mqaOMOtk61IC&pg=PA80|title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|last=I.K. Morton|last2=Judith M. Hall|date=ngày 31 tháng 10 năm 1999|publisher=Springer Science & Business Media|isbn=978-0-7514-0499-9|pages=80–}}</ref> Nó là một androgen ester – cụ thể, C17β [[Axít caproic|caproate]] [[este]]r của clostebol (4-chlorotestosterone) – và đóng vai trò tiền chất của clostebol trong cơ thể.<ref name="Elks2014" />{{Additional citation needed|date=November 2016}} Clostebol caproate được dùng thông qua [[Intramuscular injection|tiêm bắp]].<ref name="MortonHall1999" />

== Xem thêm ==

* [[Clostebol acetate|Clostebol axetat]] 
* [[Clostebol propionate]] 
* [[Norclostebol]] 
* [[Norclostebol acetate|Norclostebol axetat]] 
* [[Oxi hóa|Oxabolone]] 
* [[Oxipone cipionate]]

==Tham khảo==
{{Tham khảo}}