Xem mã nguồn của Cloxestradiol acetate

{{Infobox drug
| IUPAC_name = [(8''R'',9''S'',13''S'',14''S'',17''S'')-17-(1-Acetyloxy-2,2,2-trichloroethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[''a'']phenanthren-3-yl] acetate
| image = Cloxestradiol acetate.svg
| width = 250px

<!--Clinical data-->| tradename = Genovul
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = X (Contraindicated)
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = <!--Identifiers-->
| CAS_number = 15686-44-9
| CAS_number_Ref = 
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| PubChem = 71586995
| DrugBank = 
| DrugBank_Ref = 
| ChemSpiderID = 34989697
| ChemSpiderID_Ref = 
| synonyms = 17-(2,2,2-Trichloroethoxy)estradiol O,O-diacetate; 1-{[(17β)-3-Acetoxyestra-1,3,5(10)-trien-17-yl]oxy}-2,2,2-trichloroethyl acetate

<!--Chemical data-->| C = 24
| Cl = 3
| H = 29
| O = 5
| molecular_weight = 503.843 g/mol
| SMILES = CC(=O)OC1=CC2=C(C=C1)C3CCC4(C(C3CC2)CCC4OC(C(Cl)(Cl)Cl)OC(=O)C)C
| StdInChI = 1S/C24H29Cl3O5/c1-13(28)30-16-5-7-17-15(12-16)4-6-19-18(17)10-11-23(3)20(19)8-9-21(23)32-22(24(25,26)27)31-14(2)29/h5,7,12,18-22H,4,6,8-11H2,1-3H3/t18-,19-,20+,21+,22?,23+/m1/s1
| StdInChIKey = UEVLJPRROXDIPO-CUFSGNDSSA-N
| verifiedrevid = 
}}
'''Cloxestradiol acetate''' (tên thương hiệu '''Genovul'''), còn được gọi là '''17- (2,2,2-trichloroethoxy) estradiol ''O'', ''O'' -diacetate''', là một [[Estrogen (thuốc)|estrogen]] [[Hợp chất hữu cơ|tổng hợp]], [[steroid]] có nguồn gốc từ [[Estradiol (dược phẩm)|estradiol]].<ref name="Elks2014">{{Chú thích sách|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA308|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|last=J. Elks|date=ngày 14 tháng 11 năm 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=308–}}</ref> Đó là [[este]] ''O'', ''O'' -di [[axetat]] của [[cloxestradiol]], trái ngược với cloxestradiol acetate, không bao giờ được bán trên thị trường.<ref name="Elks2014" />

== Xem thêm ==

* [[Danh sách este estrogen |Danh sách este estrogen § Estradiol este]] 
* [[Cloxotestosterone axetat]]

== Tham khảo ==
{{Tham khảo}}
{{sơ khai}}

[[Thể loại:Este acetat]]
[[Thể loại:Estrane]]