imported>InternetArchiveBot: Add 1 book for Wikipedia:Thông tin kiểm chứng được (20260723sim)) #IABot (v2.0.9.5) (GreenC bot

2026-07-23T18:32:24Z

Add 1 book for Wikipedia:Thông tin kiểm chứng được (20260723sim)) #IABot (v2.0.9.5) (GreenC bot

Trang mới

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477242440
| ImageFile = Adenosinmonophosphat protoniert.svg
| ImageSize = 200px
| ImageName = Công thức cấu tạo của adenosine monophosphate
| ImageFile1 = Adenosine-monophosphate-anion-3D-balls.png
| ImageSize1 = 200px
| ImageName1 = Mô hình quả cầu và thanh của AMP
| IUPACName = 5′-Adenylic acid
| SystematicName = [(2''R'',3''S'',4''R'',5''R'')-5-(6-Amino-9''H''-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate
| OtherNames = Adenosine 5'-monophosphate Vitamin B8 <ref>{{cite web |title=Depositor-Supplied Synonyms |url=https://pubchem.ncbi.nlm.nih.gov/compound/6083#section=Depositor-Supplied-Synonyms |website=PubChem |publisher=NCBI}}</ref>
|Section1={{Chembox Identifiers
| PubChem = 6083
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5858
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 415SHH325A
| InChI = 1/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
| InChIKey = UDMBCSSLTHHNCD-KQYNXXCUBP
| SMILES1 = c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 752
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UDMBCSSLTHHNCD-KQYNXXCUSA-N
| CASNo = 61-19-8
| CASNo_Ref = {{cascite|correct|CAS}}
| IUPHAR_ligand = 2455
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00131
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16027
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00020
| SMILES = O=P(O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3O
| MeSHName = Adenosine+monophosphate
}}
|Section2={{Chembox Properties
| C=10 | H=14 | N=5 | O=7 | P=1
| MolarMass = 347.22 g/mol
| Appearance = bột tinh thể màu trắng
| pKa = 0.9{{citation needed|date=September 2016}}, 3.8, 6.1
| Density = 2.32 g/mL
| MeltingPtC = 178 to 185
| BoilingPtC = 798,5
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}

'''Adenosine monophosphate''' ('''AMP'''),<ref>{{Cite encyclopedia |title=AMP |encyclopedia=Henderson's Dictionary of Biological Terms |last=Lawrence |first=Eleanor |edition=10th |page=1 |isbn=0-470-21446-5}}</ref> còn được gọi là '''axit 5'-adenylic''', là một [[nucleotide]]. AMP bao gồm một nhóm [[phosphat]]e, đường [[ribose]] và base [[adenine]]; nó là một [[este]]r của [[Axit phosphoric|axit photphoric]] và [[adenosine]] [[nucleoside]].<ref>{{Chú thích web |title=Adenosine monophosphate (Compound) |url=https://pubchem.ncbi.nlm.nih.gov/compound/Adenosine-monophosphate |website=PubChem |publisher=NCBI |access-date=30 April 2020}}</ref> Là một nhóm thế, nó có dạng tiền tố '''adenylyl-'''.<ref>{{Chú thích tạp chí |title=Nomenclature of Carbohydrates: (Recommendations 1996) |journal=Journal of Carbohydrate Chemistry |date=1997 |volume=16 |issue=8 |pages=1191–1280 |doi=10.1080/07328309708005748}}</ref>

AMP đóng vai trò quan trọng trong nhiều quá trình trao đổi chất của tế bào, được chuyển đổi sang [[Adenosine diphosphat|ADP]] và/hoặc [[Adenosine triphosphat|ATP]]. AMP cũng là một thành phần trong quá trình tổng hợp [[RNA]].<ref>{{Chú thích tạp chí|vauthors=Jauker M, Griesser H, Richert C|date=November 2015|title=Spontaneous Formation of RNA Strands, Peptidyl RNA, and Cofactors|journal=Angewandte Chemie|volume=54|issue=48|pages=14564–9|doi=10.1002/anie.201506593|pmc=4678511|pmid=26435376}}</ref> AMP có mặt trong tất cả các dạng sống đã biết.<ref>{{Chú thích web |title=Adenosine monophosphate |url=https://hmdb.ca/metabolites/HMDB0000045 |website=The Human Metabolome Database |access-date=3 July 2020}}</ref>

== Hình thành và phân hủy ==
AMP không có liên kết [[Phosphate cao năng|phosphoanhydride]] cao năng liên quan đến ADP và ATP. AMP có thể được tạo ra từ [[Adenosine diphosphat|ADP]] thông qua phản ứng [[myokinase (adenylat kinase)]] khi lượng ATP dự trữ trong tế bào thấp:<ref>{{Chú thích tạp chí |last1=Baker |first1=Julien S. |last2=McCormick |first2=Marie Clare |last3=Robergs |first3=Robert A. |date=2010 |title=Interaction among Skeletal Muscle Metabolic Energy Systems during Intense Exercise |journal=Journal of Nutrition and Metabolism |volume=2010 |article-number=905612 |doi=10.1155/2010/905612 |issn=2090-0732 |pmc=3005844 |pmid=21188163 |doi-access=free }}</ref><ref>{{Chú thích |last=Valberg |first=Stephanie J. |title=Chapter 15 - Skeletal Muscle Function |date=2008-01-01 |url=https://www.sciencedirect.com/science/article/pii/B9780123704917000155 |work=Clinical Biochemistry of Domestic Animals (Sixth Edition) |pages=459–484 |editor-last=Kaneko |editor-first=J. Jerry |access-date=2023-10-10 |place=San Diego |publisher=Academic Press |isbn=978-0-12-370491-7 |editor2-last=Harvey |editor2-first=John W. |editor3-last=Bruss |editor3-first=Michael L.}}</ref>

: 2 ADP → ATP + AMP

Hoặc AMP tạo ra bằng cách [[thủy phân]] một liên kết [[phosphate cao năng]] của ADP:

: ADP + H2O → AMP + [[Phosphat|Pi]]

AMP cũng hình thành bằng cách thủy phân [[Adenosine triphosphat|ATP]] thành AMP và [[pyrophosphate]]:

: ATP + H2O → AMP + [[Pyrophosphate|PPi]]

Khi RNA bị phá vỡ bởi các hệ thống sống, các nucleoside monophosphate, bao gồm adenosine monophosphate, được hình thành.

AMP tái tạo thành ATP như sau:

: AMP + ATP → 2 ADP (adenylate kinase theo hướng ngược lại)
: ADP + Pi → ATP (bước này thường được thực hiện trong aerobes bởi [[ATP synthase]] trong quá trình [[phosphoryl oxy hóa]])

AMP biến đổi thành [[Inosine monophosphate|IMP]] nhờ [[enzym]]e [[myoadenylate deaminase]], giải phóng một nhóm [[amonia]].

Trong con đường dị hóa, adenosine monophosphate chuyển đổi thành [[axit uric]], được bài tiết ra khỏi cơ thể ở động vật có vú.<ref>{{Chú thích tạp chí|vauthors=Maiuolo J, Oppedisano F, Gratteri S, Muscoli C, Mollace V|date=June 2016|title=Regulation of uric acid metabolism and excretion|url=https://www.sciencedirect.com/science/article/pii/S0167527315303429|journal=International Journal of Cardiology|volume=213|pages=8–14|doi=10.1016/j.ijcard.2015.08.109|pmid=26316329}}</ref>

== cAMP ==
{{Main|AMP vòng}}
AMP cũng có thể tồn tại như một cấu trúc vòng được gọi là [[Cyclic adenosine monophosphate|AMP vòng]] (hoặc cAMP). Trong một số tế bào, enzyme [[Adenylat cyclaza|adenylate cyclase]] tạo ra cAMP từ ATP, và thông thường phản ứng này được điều chỉnh bởi các hormone như [[adrenaline]] hoặc [[glucagon]]. cAMP đóng vai trò quan trọng trong việc truyền tín hiệu nội bào.<ref>{{Chú thích sách|title=Metabolic Control|last=Ravnskjaer|first=Kim|last2=Madiraju|first2=Anila|last3=Montminy|first3=Marc|date=2015|publisher=Springer, Cham|isbn=9783319298047|series=Handbook of Experimental Pharmacology|volume=233|pages=29–49|doi=10.1007/164_2015_32|pmid=26721678|name-list-style=vanc}}</ref> Trong cơ vân, AMP vòng, được kích hoạt bởi adrenaline, bắt đầu một chuỗi phản ứng ([[con đường phụ thuộc cAMP]]) để chuyển đổi myophosphorylase-b thành dạng phosphoryl hóa của [[myophosphorylase]]-a để phân giải glycogen.<ref>{{Chú thích sách |last=Coffee |first=Carole J. |title=Quick Look Medicine: Metabolism |publisher=Hayes Barton Press |year=1999 |isbn=1-59377-192-4}}</ref><ref>{{Chú thích sách |date=2022-01-01 |chapter=15.3: Glycogenolyis and its Regulation by Glucagon and Epinephrine Signaling |chapter-url=https://bio.libretexts.org/Bookshelves/Biochemistry/Fundamentals_of_Biochemistry_(Jakubowski_and_Flatt)/02%3A_Unit_II-_Bioenergetics_and_Metabolism/15%3A_Glucose_Glycogen_and_Their_Metabolic_Regulation/15.03%3A_15.3_Glycogenolyis_and_its_Regulation_by_Glucagon_and_Epinephrine_Signaling |access-date=2023-10-10 |via=Biology LibreTexts |language=en|title=Fundamentals of Biochemistry|first1=Henry|last1=Jakubowski|first2=Patricia|last2=Flatt}}</ref>

== Tham khảo ==
{{Tham khảo|32em}}

== Đọc thêm ==
{{refbegin}}
* {{chú thích tạp chí|vauthors=Ming D, Ninomiya Y, Margolskee RF|title=Blocking taste receptor activation of gustducin inhibits gustatory responses to bitter compounds|url=https://archive.org/details/sim_proceedings-of-the-national-academy-of-sciences-usa_1999-08-17_96_17/page/9903|journal=Proceedings of the National Academy of Sciences of the United States of America|volume=96|issue=17|pages=9903–8|date=August 1999|pmid=10449792|pmc=22308|doi=10.1073/pnas.96.17.9903}}
{{refend}}

== Liên kết ngoài ==

* [http://gmd.mpimp-golm.mpg.de/Spectrums/661B03AA-D8B1-4A01-9CEA-6BCEF0E7B15C.aspx Quang phổ MS GMD]

[[Thể loại:Purine]]
[[Thể loại:Chất dẫn truyền thần kinh]]

Adenosine monophosphat - Lịch sử thay đổi

imported>InternetArchiveBot: Add 1 book for Wikipedia:Thông tin kiểm chứng được (20260723sim)) #IABot (v2.0.9.5) (GreenC bot