https://wikibeta.org/index.php?action=history&feed=atom&title=Amezinium_metilsulfate
Amezinium metilsulfate - Lịch sử thay đổi
2026-08-11T14:29:15Z
Lịch sử thay đổi trang này trên wiki
MediaWiki 1.46.0
https://wikibeta.org/index.php?title=Amezinium_metilsulfate&diff=7134189&oldid=prev
imported>AnsterBot: (Bot) AlphamaEditor, thêm thể loại, Executed time: 00:00:05.3929138
2025-04-27T14:34:48Z
<p>(Bot) <a href="/wiki/Th%C3%A0nh_vi%C3%AAn:AnsterBot#AlphamaEditor" title="Thành viên:AnsterBot">AlphamaEditor</a>, thêm thể loại, Executed time: 00:00:05.3929138</p>
<p><b>Trang mới</b></p><div>{{Infobox drug<br />
| IUPAC_name = 6-Methoxy-1-phenylpyridazin-1-ium-4-amine; methyl sulfate<br />
| image = Structural formula of amezinium metilsulfate.svg<br />
<br />
<!--Clinical data-->| tradename = <br />
| Drugs.com = {{drugs.com|international|amezinium-metilsulfate}}<br />
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --><br />
| pregnancy_US = <!-- A / B / C / D / X --><br />
| pregnancy_category = <br />
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--><br />
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --><br />
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --><br />
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --><br />
| legal_status = Rx-only<br />
| routes_of_administration = Oral<br />
<br />
<!--Pharmacokinetic data-->| bioavailability = <br />
| protein_bound = <br />
| metabolism = <br />
| elimination_half-life = <br />
| excretion = <!--Identifiers--><br />
| CAS_number = 30578-37-1<br />
| CAS_number_Ref = {{cascite|changed|??}}<br />
| ATC_prefix = C01<br />
| ATC_suffix = CA25<br />
| ATC_supplemental = <br />
| PubChem = 71926<br />
| DrugBank = <br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| ChemSpiderID = 64937<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| UNII = 03NR868ICX<br />
| UNII_Ref = {{fdacite|changed|FDA}}<br />
| KEGG = D01304<br />
<br />
<!--Chemical data-->| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| ChEMBL = 2106667<br />
| ChEMBL_Ref = {{ebicite|changed|EBI}}<br />
| chemical_formula = <br />
| C = 12<br />
| H = 15<br />
| N = 3<br />
| O = 5<br />
| S = 1<br />
| molecular_weight = 313.32 g/mol<br />
| SMILES = COC1=[N+](N=CC(=C1)N)C2=CC=CC=C2.COS(=O)(=O)[O-]<br />
| StdInChI = 1S/C11H11N3O.CH4O4S/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-8,12H,1H3;1H3,(H,2,3,4)<br />
| StdInChIKey = ZEASXVYVFFXULL-UHFFFAOYSA-N<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| verifiedrevid = 456687368<br />
}}<br />
'''Amezinium metilsulfate''' ([[Tên quốc tế phi thương mại|INN]], tên thương mại '''Regulton''') là một loại thuốc [[Thuốc kích thích giao cảm|giao cảm]] được sử dụng để điều trị [[Huyết áp|huyết áp thấp]]. Nó có nhiều cơ chế, bao gồm kích thích [[Thụ thể Beta-1|thụ thể]] [[Alpha thụ thể|alpha]] và [[Thụ thể Beta-1|beta-1]] và ức chế sự hấp thu [[Norepinephrine|noradrenaline]] và [[tyramine]].<ref>{{Chú thích tạp chí|last=Araújo|first=D|last2=Caramona|first2=MM|last3=Osswald|first3=W|year=1983|title=On the mechanism of action of amezinium methylsulphate on the dog saphenous vein|journal=European Journal of Pharmacology|volume=90|issue=2–3|pages=203–14|doi=10.1016/0014-2999(83)90238-8|pmid=6873182}}</ref><ref>{{Chú thích tạp chí|last=Lenke|first=D.|last2=Gries|first2=J.|last3=Kretzschmar|first3=R.|year=1981|title=Pharmacology of amezinium, a novel antihypotensive drug. III. Studies on the mechanism of action|journal=Arzneimittel-Forschung|volume=31|issue=9a|pages=1558–1565|pmid=7197970}}</ref><br />
<br />
==Tham khảo==<br />
{{Tham khảo}}<br />
<br />
[[Thể loại:Methyl este]]</div>
imported>AnsterBot