https://wikibeta.org/index.php?action=history&feed=atom&title=Chlorphenesin_carbamateChlorphenesin carbamate - Lịch sử thay đổi2026-08-11T03:09:45ZLịch sử thay đổi trang này trên wikiMediaWiki 1.46.0https://wikibeta.org/index.php?title=Chlorphenesin_carbamate&diff=7129639&oldid=previmported>TARGET6tidiem-Cat-a-lot: Di chuyển từ Category:Ete phenol đến Category:Ether phenol dùng Cat-a-lot2021-11-09T03:31:41Z<p>Di chuyển từ <a href="/wiki/Th%E1%BB%83_lo%E1%BA%A1i:Ete_phenol" title="Thể loại:Ete phenol">Category:Ete phenol</a> đến <a href="/wiki/Th%E1%BB%83_lo%E1%BA%A1i:Ether_phenol" title="Thể loại:Ether phenol">Category:Ether phenol</a> dùng <a href="/index.php?title=C:Help:Cat-a-lot&action=edit&redlink=1" class="new" title="C:Help:Cat-a-lot (trang không tồn tại)">Cat-a-lot</a></p>
<p><b>Trang mới</b></p><div>{{Infobox drug<br />
| IUPAC_name = (3-(4-chlorophenoxy)-2-hydroxypropyl)carbamate<br />
| image = Chlorphenesin.png<br />
<!--Clinical data-->| tradename = <br />
| Drugs.com = {{drugs.com|CONS|chlorphenesin}}<br />
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --><br />
| pregnancy_US = <!-- A / B / C / D / X --><br />
| pregnancy_category = <br />
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --><br />
| legal_UK = <!-- GSL / P / POM / CD --><br />
| legal_US = <!-- OTC / Rx-only --><br />
| legal_status = <br />
| routes_of_administration = <!--Pharmacokinetic data--><br />
| bioavailability = <br />
| protein_bound = <br />
| metabolism = <br />
| elimination_half-life = <br />
| excretion = urine<br />
<br />
<!--Identifiers-->| CAS_number = 886-74-8<br />
| ATC_prefix = D01<br />
| ATC_suffix = AE07<br />
| ATC_supplemental = <br />
| PubChem = 2724<br />
| DrugBank = <br />
| ChemSpiderID = 2623<br />
| UNII = I670DAL4SZ<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| KEGG = D00770<br />
| ChEBI = 3642<br />
| ChEBI_Ref = {{ebicite|correct|EBI}}<br />
| ChEMBL = 607710<br />
<br />
<!--Chemical data-->| ChEMBL_Ref = {{ebicite|correct|EBI}}<br />
| C = 10<br />
| Cl = 1<br />
| H = 12<br />
| N = 1<br />
| O = 4<br />
| molecular_weight = 245.660 g/mol<br />
| SMILES = c1cc(ccc1OCC(COC(=O)N)O)Cl<br />
| StdInChI = 1S/C10H12ClNO4/c11-7-1-3-9(4-2-7)15-5-8(13)6-16-10(12)14/h1-4,8,13H,5-6H2,(H2,12,14)<br />
| StdInChIKey = SKPLBLUECSEIFO-UHFFFAOYSA-N<br />
| melting_point = 86<br />
| melting_high = 92<br />
}}<br />
'''Clorphenesin carbamate''' ('''Maolate''', '''Musil''') là một [[Giãn cơ bắp|thuốc giãn cơ]] hoạt động tập trung được sử dụng để điều trị đau cơ và [[co thắt]].<ref>{{Chú thích tạp chí|last=Okuyama|first=S|last2=Aihara|first2=H|year=1987|title=Antinociceptive effect of chlorphenesin carbamate in adjuvant arthritic rats|journal=Research Communications in Chemical Pathology and Pharmacology|volume=55|issue=2|pages=147–60|pmid=3823606}}</ref><ref>{{Chú thích tạp chí|last=Kurachi|first=M|last2=Aihara|first2=H|year=1984|title=Effect of a muscle relaxant, chlorphenesin carbamate, on the spinal neurons of rats|journal=Japanese Journal of Pharmacology|volume=36|issue=1|pages=7–13|doi=10.1254/jjp.36.7|pmid=6503049}}</ref> Clorphenesin không còn được sử dụng cho mục đích này ở hầu hết các quốc gia phát triển do có sẵn các loại thuốc co thắt an toàn hơn nhiều như [[Benzodiazepine|các thuốc benzodiazepin]].<br />
<br />
Các tác dụng trung tâm khác bao gồm an thần, giải lo [[Thuốc giải lo âu|âu]] và chóng mặt.<br />
<br />
== An toàn ==<br />
<br />
==Tham khảo==<br />
{{Tham khảo}}<br />
<br />
{{sơ khai}}<br />
<br />
[[Thể loại:Ether phenol]]<br />
[[Thể loại:Thuốc giãn cơ]]</div>imported>TARGET6tidiem-Cat-a-lot