https://wikibeta.org/index.php?action=history&feed=atom&title=Clofoctol
Clofoctol - Lịch sử thay đổi
2026-08-11T16:50:39Z
Lịch sử thay đổi trang này trên wiki
MediaWiki 1.46.0
https://wikibeta.org/index.php?title=Clofoctol&diff=7143935&oldid=prev
imported>Estonian Ball Mapper: /* Tham khảo */
2026-07-01T04:54:39Z
<p><span class="autocomment">Tham khảo</span></p>
<p><b>Trang mới</b></p><div>{{Infobox drug<br />
| IUPAC_name = 2-[(2,4-dichlorophenyl)methyl]-<br>4-(2,4,4-trimethylpentan-2-yl)phenol<br />
| image = Clofoctol.svg<br />
| width = 250<br />
| alt = Structural formula of clofoctol<br />
| image2 = Clofoctol 3D ball.png<br />
| width2 = 220<br />
<br />
<!--Clinical data-->| alt2 = Ball-and-stick model of the clofoctol molecule<br />
| tradename = <br />
| Drugs.com = {{drugs.com|international|clofoctol}}<br />
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --><br />
| pregnancy_US = <!-- A / B / C / D / X --><br />
| pregnancy_category = <br />
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --><br />
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --><br />
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --><br />
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --><br />
| legal_status = <br />
| routes_of_administration = Rectal ([[suppository]])<br />
<br />
<!--Pharmacokinetic data-->| bioavailability = 98%<br />
| protein_bound = <br />
| metabolism = [[Hepatic]] [[glucuronidation]]<br />
| elimination_half-life = <br />
| excretion = Biliary<br />
<br />
<!--Identifiers-->| CAS_number = 37693-01-9<br />
| CAS_number_Ref = {{cascite|correct|??}}<br />
| ATC_prefix = J01<br />
| ATC_suffix = XX03<br />
| PubChem = 2799<br />
| DrugBank = <br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| ChemSpiderID = 2697<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| UNII = 704083NI0R<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| KEGG = D07244<br />
<br />
<!--Chemical data-->| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| ChEMBL = 1476605<br />
| C = 21<br />
| Cl = 2<br />
| H = 26<br />
| O = 1<br />
| molecular_weight = 365.336 g/mol<br />
| SMILES = Clc1cc(Cl)ccc1Cc2cc(ccc2O)C(C)(C)CC(C)(C)C<br />
| StdInChI = 1S/C21H26Cl2O/c1-20(2,3)13-21(4,5)16-7-9-19(24)15(11-16)10-14-6-8-17(22)12-18(14)23/h6-9,11-12,24H,10,13H2,1-5H3<br />
| StdInChIKey = HQVZOORKDNCGCK-UHFFFAOYSA-N<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| verifiedrevid = 443553734<br />
}}<br />
'''Clofoctol''' là một [[Kháng sinh|loại kháng sinh]] [[Vi khuẩn|kìm khuẩn]]. Nó được sử dụng trong điều trị [[Đường hô hấp|trùng đường hô hấp]] và tai, mũi và viêm họng gây ra bởi [[vi khuẩn Gram dương]] [[vi khuẩn]].<ref name="Gramplus">{{Chú thích web|url=http://www.torrinomedica.it/studio/schedefarmaci/GRAMPLUS.htm|title=Gramplus|date=ngày 25 tháng 7 năm 2007|publisher=Studio Medico Torrino|language=it|access-date =ngày 10 tháng 8 năm 2007|archive-date = ngày 8 tháng 3 năm 2016 |archive-url=https://web.archive.org/web/20160308161155/http://www.torrinomedica.it/studio/schedefarmaci/gramplus.htm|url-status=dead}}</ref> Nó được bán ở [[Pháp]] dưới tên thương mại '''Octoplus''' và ở [[Ý]] với tên '''Gramplus'''.<br />
<br />
Nó chỉ có chức năng chống lại [[Vi khuẩn Gram dương|vi khuẩn gram dương]].<ref name="pmid6782374">{{Chú thích tạp chí|vauthors=Combe J, Simonnet F, Yablonsky F, Simonnet G|year=1980|title=[Clofoctol binding by the bacteria (author's transl)]|url=https://archive.org/details/sim_journal-de-pharmacologie_1980-12_11_4/page/411|journal=J Pharmacol|language=fr|volume=11|issue=4|pages=411–25|doi=|pmid=6782374}}</ref><br />
<br />
Nó xâm nhập vào mô phổi của con người.<ref name="pmid3391105">{{Chú thích tạp chí|vauthors=Danesi R, Gasperini M, Senesi S, Freer G, Angeletti CA, Del Tacca M|year=1988|title=A pharmacokinetic study of clofoctol in human plasma and lung tissue by using a microbiological assay|url=https://archive.org/details/sim_drugs-under-experimental-and-clinical-research_1988_14_1/page/39|journal=Drugs Exp Clin Res|volume=14|issue=1|pages=39–43|doi=|pmid=3391105}}</ref><br />
<br />
==Tham khảo==<br />
{{Tham khảo}}<br />
{{Kháng sinh khác}}<br />
[[Thể loại:Lớp phenol]]<br />
[[Thể loại:Kháng sinh]]</div>
imported>Estonian Ball Mapper