https://wikibeta.org/index.php?action=history&feed=atom&title=Eperezolid
Eperezolid - Lịch sử thay đổi
2026-08-10T08:59:29Z
Lịch sử thay đổi trang này trên wiki
MediaWiki 1.46.0
https://wikibeta.org/index.php?title=Eperezolid&diff=7127833&oldid=prev
imported>AnsterBot: (Bot) AlphamaEditor, Executed time: 00:00:01.0907874
2026-03-23T09:33:50Z
<p>(Bot) <a href="/wiki/Th%C3%A0nh_vi%C3%AAn:AnsterBot#AlphamaEditor" title="Thành viên:AnsterBot">AlphamaEditor</a>, Executed time: 00:00:01.0907874</p>
<p><b>Trang mới</b></p><div>{{Infobox drug<br />
| IUPAC_name = (''S'')-''N''-<nowiki>[[</nowiki>3-[3-Fluoro-4-[4-(2-hydroxyacetyl)piperazin-<br/>1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide<br />
| image = Eperezolid.png<br />
| width = 260<br />
| alt = Skeletal formula of eperezolid<br />
| image2 = Eperezolid 3D spacefill.png<br />
| alt2 = Space-filling model of the eperezolid molecule<br />
<br />
<!--Clinical data-->| tradename = <br />
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --><br />
| pregnancy_US = <!-- A / B / C / D / X --><br />
| pregnancy_category = <br />
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--><br />
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --><br />
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --><br />
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --><br />
| legal_status = <br />
| routes_of_administration = <!--Pharmacokinetic data--><br />
| bioavailability = <br />
| protein_bound = <br />
| metabolism = <br />
| elimination_half-life = <br />
| excretion = <!--Identifiers--><br />
| CAS_number = 165800-04-4<br />
| CAS_number_Ref = {{cascite|correct|??}}<br />
| ATC_prefix = <br />
| ATC_suffix = <br />
| PubChem = 73214<br />
| DrugBank = <br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| ChemSpiderID = 65969<br />
<br />
<!--Chemical data-->| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}<br />
| UNII = C460ZSU1OW<br />
| UNII_Ref = {{fdacite|changed|FDA}}<br />
| KEGG = D04017<br />
| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| ChEMBL = 47955<br />
| ChEMBL_Ref = {{ebicite|changed|EBI}}<br />
| C = 18<br />
| F = 1<br />
| H = 23<br />
| N = 4<br />
| O = 5<br />
| molecular_weight = 394.40<br />
| SMILES = CC(=O)NC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCN(CC3)C(=O)CO)F<br />
| StdInChI = 1S/C18H23FN4O5/c1-12(25)20-9-14-10-23(18(27)28-14)13-2-3-16(15(19)8-13)21-4-6-22(7-5-21)17(26)11-24/h2-3,8,14,24H,4-7,9-11H2,1H3,(H,20,25)/t14-/m0/s1<br />
| StdInChIKey = SIMWTRCFFSTNMG-AWEZNQCLSA-N<br />
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}<br />
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}<br />
| verifiedrevid = 406013269<br />
}}<br />
'''Eperezolid''' là một [[Kháng sinh|loại kháng sinh]] [[oxazolidinone]].<br />
<br />
== Tổng hợp ==<br />
[[Tập tin:Eperezolid_synthesis.png|giữa|nhỏ|600x600px| Tổng hợp eperezolid <ref>{{Chú thích tạp chí|last=Brickner|first=S. J.|last2=Hutchinson|first2=D. K.|last3=Barbachyn|first3=M. R.|last4=Manninen|first4=P. R.|last5=Ulanowicz|first5=D. A.|last6=Garmon|first6=S. A.|last7=Grega|first7=K. C.|last8=Hendges|first8=S. K.|last9=Toops|first9=D. S.|year=1996|title=Synthesis and Antibacterial Activity of U-100592 and U-100766, Two Oxazolidinone Antibacterial Agents for the Potential Treatment of Multidrug-Resistant Gram-Positive Bacterial Infections|journal=Journal of Medicinal Chemistry|volume=39|issue=3|pages=673–9|doi=10.1021/jm9509556|pmid=8576909}}</ref>]]<br />
<br />
== Xem thêm ==<br />
[[Linezolid]]<br />
<br />
==Tham khảo==<br />
{{Tham khảo}}<br />
{{Kháng sinh ức chế tổng hợp protein}}<br />
<br />
[[Thể loại:Alcohol bậc một]]<br />
<br />
<br />
{{Chem-stub}}</div>
imported>AnsterBot