imported>TARGET6tidiem: TARGET6tidiem đã đổi Kali canrenoate thành Kali canrenoat: TCVN

2022-09-02T04:32:21Z

TARGET6tidiem đã đổi Kali canrenoate thành Kali canrenoat: TCVN

Trang mới

{{Infobox drug
| IUPAC_name = potassium 3-[(8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-<br />17-hydroxy-10,13-dimethyl-3-oxo-2,8,9,<br />11,12,14,15,16-octahydro-1''H''-cyclopenta[a]<br />phenanthren-17-yl]propanoate
| image = Potassium canrenoate.svg
| width = 250px

| tradename =
| Drugs.com = {{drugs.com|international|potassium-canrenoate}}
| pregnancy_AU = 
| pregnancy_US = 
| pregnancy_category =
| legal_AU = 
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status =
| routes_of_administration = [[Intravenous therapy|Intravenous]]

| bioavailability =
| protein_bound =
| metabolism = [[Gan]]
| elimination_half-life =
| excretion = [[Thận]] and fecal

| CAS_number = 2181-04-6
| CAS_number_Ref = {{cascite|changed|??}}
| ATC_prefix = C03
| ATC_suffix = DA02
| PubChem = 23671691
| DrugBank = DB09015
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| ChemSpiderID = 570975
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = M671F9NLEA
| UNII_Ref = {{fdacite|changed|FDA}}
| ChEMBL = 1371200
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| synonyms = SC-14266

| chemical_formula =
| C = 22
| H = 29
| K = 1
| O = 4
| molecular_weight = 396.5616 g/mol
| SMILES = [K+].[O-]C(=O)CC[C@]3(O)CC[C@H]2[C@@H]4/C=C\C1=C\C(=O)CC[C@@]1([C@H]4CC[C@@]23C)C
| StdInChI = 1S/C22H30O4.K/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21,26)12-8-19(24)25;/h3-4,13,16-18,26H,5-12H2,1-2H3,(H,24,25);/q;+1/p-1/t16-,17+,18+,20+,21+,22-;/m1./s1
| StdInChIKey = JTZQCHFUGHIPDF-RYVBEKKQSA-M
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| verifiedrevid = 464211168
}}
'''Kali canrenoate''' ([[Tên quốc tế phi thương mại|INN]], [[Tên được chấp nhận của Nhật Bản|JAN]]) hoặc '''kali canrenoate''' ([[Tên thông qua Hoa Kỳ|USAN)]] (tên thương hiệu '''Venactone,''' '''Soldactone)),''' còn được gọi là '''aldadiene kalium,''' <ref name="Selye2013">{{Chú thích sách|url=https://books.google.com/books?id=NdvnCAAAQBAJ&pg=PA186|title=Hormones and Resistance: Part 1 and|last=Hans Selye|date=17 April 2013|publisher=Springer Science & Business Media|isbn=978-3-642-65192-2|pages=186–}}</ref> các [[kali]] [[Muối (hóa học)|muối]] của [[axit canrenoic]], là một [[Thuốc đối kháng Aldosterone|chất đối kháng aldosterone]] của nhóm [[Tảo xoắn|spirolactone]].<ref name="HillMakin1991">{{Chú thích sách|url=https://books.google.com/books?id=qw5X0NK1A90C&pg=PA656|title=Dictionary of Steroids|last=R.A. Hill|last2=H.L.J. Makin|last3=D.N. Kirk|last4=G.M. Murphy|date=23 May 1991|publisher=CRC Press|isbn=978-0-412-27060-4|pages=656–}}</ref> Giống như [[spironolactone]], nó là một tiền chất, và được [[Chuyển hóa thuốc|chuyển hóa]] thành [[canrenone]] hoạt động trong cơ thể.<ref name="BurgerWolff1996">{{Chú thích sách|url=https://books.google.com/books?id=iLvwAAAAMAAJ|title=Burger's Medicinal Chemistry and Drug Discovery: Therapeutic agents|last=Alfred Burger|last2=Manfred E. Wolff|publisher=Wiley|year=1996|isbn=978-0-471-57557-3}}</ref><ref name="WaldmannSoni2008">{{Chú thích sách|url=https://books.google.com/books?id=eLqMpXfAlEcC&pg=PA187|title=Oxford Desk Reference: Critical Care|last=Carl Waldmann|last2=Neil Soni|last3=Andrew Rhodes|date=27 November 2008|publisher=OUP Oxford|isbn=978-0-19-922958-1|pages=187–}}</ref>

Canrenoate kali là đáng chú ý ở chỗ nó là chỉ được sử dụng trên lâm sàng các antimineralocorticoid trong đó có sẵn cho dùng đường tiêm (đặc biệt là tiêm tĩnh mạch) <ref name="WaldmannSoni2008"/><ref name="Bonjer2017">{{Chú thích sách|url=https://books.google.com/books?id=tAImDwAAQBAJ&pg=PA136|title=Surgical Principles of Minimally Invasive Procedures: Manual of the European Association of Endoscopic Surgery (EAES)|last=H. Jaap Bonjer|date=21 June 2017|publisher=Springer|isbn=978-3-319-43196-3|pages=136–}}</ref> như trái ngược với đường uống.<ref name="pmid28634268">{{Chú thích tạp chí|vauthors=Kolkhof P, Bärfacker L|year=2017|title=30 YEARS OF THE MINERALOCORTICOID RECEPTOR: Mineralocorticoid receptor antagonists: 60 years of research and development|journal=J. Endocrinol.|volume=234|issue=1|pages=T125–T140|doi=10.1530/JOE-16-0600|pmc=5488394|pmid=28634268}}</ref>

== Xem thêm ==

* [[Axit canrenoic]]
* [[Canrenone]]

==Tham khảo==
{{Tham khảo|30em}}

[[Thể loại:Hợp chất kali]]
[[Thể loại:Bài viết chứa mã định danh DrugBank đã thay đổi]]

Kali canrenoat - Lịch sử thay đổi

imported>TARGET6tidiem: TARGET6tidiem đã đổi Kali canrenoate thành Kali canrenoat: TCVN