imported>Estonian Ball Mapper: /* Tham khảo */

2026-07-01T06:34:32Z

Tham khảo

Trang mới

{{Infobox drug
| IUPAC_name = (4S'',''5''R'',6''R'')-5-acetamido-4-carbamimidamido-6-[(1''R'',2''R'')-3-hydroxy-2-methoxypropyl]-5,6-dihydro-4''H''-pyran-2-carboxylic acid
| image = Laninamivir.svg
| width = 200px

| tradename =
| routes_of_administration = Inhalation

| CAS_number = 203120-17-6
| CAS_number_Ref = {{cascite|changed|??}}
| ATC_prefix = J05
| ATC_suffix = AH04
| PubChem = 502272
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID = 439182
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = B408IW3GL5

| UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL = 466246
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| C = 13
| H = 22
| N = 4
| O = 7
| molecular_weight = 346.33638 g/mol
| SMILES = O=C(O)C=1O[C@@H]([C@H](OC)[C@H](O)CO)[C@H](NC(=O)C)[C@@H](/N=C(\N)N)C=1
| StdInChI = 1S/C13H22N4O7/c1-5(19)16-9-6(17-13(14)15)3-8(12(21)22)24-11(9)10(23-2)7(20)4-18/h3,6-7,9-11,18,20H,4H2,1-2H3,(H,16,19)(H,21,22)(H4,14,15,17)/t6-,7+,9+,10+,11+/m0/s1
| StdInChIKey = QNRRHYPPQFELSF-CNYIRLTGSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| verifiedrevid = 462088695
}}
[[Tập tin:Inavir.jpg|nhỏ|Inavir]]
'''Laninamivir''' ('''CS-8958''') là một [[chất ức chế neuraminidase]] đang được nghiên cứu để điều trị và điều trị [[Y học dự phòng|dự phòng]] Influenzavirus A và Influenzavirus B.<ref name="pmid18955520">{{Chú thích tạp chí|vauthors=Yamashita M, Tomozawa T, Kakuta M, Tokumitsu A, Nasu H, Kubo S|date=January 2009|title=CS-8958, a prodrug of the new neuraminidase inhibitor R-125489, shows long-acting anti-influenza virus activity|url=https://archive.org/details/sim_antimicrobial-agents-and-chemotherapy_2009-01_53_1/page/186|journal=Antimicrobial Agents and Chemotherapy|volume=53|issue=1|pages=186–92|doi=10.1128/AAC.00333-08|pmc=2612152|pmid=18955520}}</ref> Nó hiện đang trong giai đoạn thử nghiệm lâm sàng giai đoạn III.<ref name="pmid19067613">{{Chú thích tạp chí|last=Hayden F|date=January 2009|title=Developing new antiviral agents for influenza treatment: what does the future hold?|url=|journal=Clinical Infectious Diseases|series=48|volume=Suppl 1|issue=S1|pages=S3–13|doi=10.1086/591851|pmid=19067613}}</ref> Nó là một chất ức chế neuraminidase tác dụng kéo dài bằng cách hít vào mũi.<ref name="samson review">{{Chú thích tạp chí|last=Samson|first=M|last2=Pizzorno, A|last3=Abed, Y|last4=Boivin, G|date=May 2013|title=Influenza virus resistance to neuraminidase inhibitors.|journal=Antiviral Research|volume=98|issue=2|pages=174–85|doi=10.1016/j.antiviral.2013.03.014|pmid=23523943}}</ref>

Laninamivir đã được phê duyệt để điều trị cúm tại Nhật Bản vào năm 2010 và điều trị dự phòng vào năm 2013. Nó hiện đang được bán trên thị trường dưới tên '''Inavir''' bởi Daiichi Sankyo. Biota Dược phẩm <ref>{{Chú thích web |url=http://www.biotapharma.com/ |ngày truy cập=2019-06-17 |tựa đề=Bản sao đã lưu trữ |archive-date=2016-04-17 |archive-url=https://web.archive.org/web/20160417124102/http://www.biotapharma.com/ |url-status=dead }}</ref> và Lanichi Sankyo đồng sở hữu Laninamivir. Vào ngày 1 tháng 4 năm 2011, BARDA đã trao một khoản tiền ước tính lên tới $230 triệu cho Công ty Biota Dược phẩm (trước đây là Biota Holdings Ltd), công ty con thuộc sở hữu của Biota Science Management Pty Ltd, cho sự phát triển tiên tiến của Laninamivir tại Hoa Kỳ.<ref>{{Chú thích web |url=http://www.biotapharma.com/?page=1021001&subpage=1021019 |ngày truy cập=2019-06-17 |tựa đề=Bản sao đã lưu trữ |archive-date=2016-03-05 |archive-url=https://web.archive.org/web/20160305125510/http://biotapharma.com/?page=1021001&subpage=1021019 |url-status=dead }}</ref> Đó là theo đánh giá lâm sàng ở các nước khác.<ref name="samson review"/>

==Tham khảo==
{{Tham khảo}}
{{Thuốc kháng virus RNA}}

Laninamivir - Lịch sử thay đổi

imported>Estonian Ball Mapper: /* Tham khảo */