imported>AnsterBot: (Bot) AlphamaEditor, thêm thể loại, Executed time: 00:00:05.2204015

2025-06-12T12:24:02Z

(Bot) AlphamaEditor, thêm thể loại, Executed time: 00:00:05.2204015

Trang mới

{{Infobox drug
| IUPAC_name = (8''R'',9''S'',10''R'',13''S'',14''S'',17''S'')-4-Chloro-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-one
| image = Norclostebol.svg
| width = 215px
| image2 = Norclostebol molecule ball.png
| width2 = 225px

| tradename = Lentabol
| pregnancy_AU = 
| pregnancy_US = 
| pregnancy_category =
| legal_AU = 
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = 
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion = 
| CAS_number = 13583-21-6
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 166576
| IUPHAR_ligand =
| DrugBank =
| DrugBank_Ref =
| ChemSpiderID = 145769
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| UNII = VI1001O2DI
| UNII_Ref = {{fdacite|correct|FDA}}
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = SKF-6611; CP-73; 4-Chloroestr-4-en-17β-ol-3-one

| C = 18
| Cl = 1
| H = 25
| O = 2
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C(C(=O)CC[C@H]34)Cl
| StdInChI = 1S/C18H25ClO2/c1-18-9-8-11-10-4-6-15(20)17(19)13(10)3-2-12(11)14(18)5-7-16(18)21/h10-12,14,16,21H,2-9H2,1H3/t10-,11-,12-,14+,16+,18+/m1/s1
| StdInChIKey = OZDDFAQVVGFDJP-YGRHGMIBSA-N
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| verifiedrevid = 444588255
}}
'''Norclostebol''' ({{Abbrlink|INN|International Nonproprietary Name}}; tên thương hiệu '''Lentabol'''; tên mã phát triển cũ '''SKF-6611''', '''CP-73''') là một [[Steroid đồng hóa|steroid]] [[Hợp chất hữu cơ|tổng hợp]] [[androgen]] và đồng hóa (AAS) có nguồn gốc từ [[nandrolone]].<ref name="Elks2014">{{Chú thích sách|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA168|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|last=J. Elks|date=ngày 14 tháng 11 năm 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=168–}}</ref><ref name="FFFLM2007">{{Chú thích sách|url=https://books.google.com/books?id=bniSB1_pouYC&pg=PA67|title=Pathology, Toxicogenetics, and Criminalistics of Drug Abuse|last=Steven B. Karch, MD, FFFLM|date=ngày 9 tháng 10 năm 2007|publisher=CRC Press|isbn=978-1-4200-5456-9|pages=67–}}</ref><ref name="Wright1982">{{Chú thích sách|url=https://books.google.com/books?id=PYNFAAAAYAAJ|title=Anabolic Steroids and Sports: A Comprehensive, Up-to-date Summary and Discussion of the Scientific Findings about the Controversial Drugs Widely Used to Increase Muscle Size and Strength|last=James Edward Wright|publisher=Sports Science Consultants|year=1982|isbn=978-0-9609306-0-9}}</ref> Nó được mô tả trong các tài liệu vào năm 1957.<ref name="Elks2014" /> Norclostebol cũng được sử dụng như một [[este]]r, [[norclostebol acetate]] (tên thương hiệu '''Anabol 4-19''').

Norclostebol là một dẫn xuất 4-chloro của [[testosterone]]. Nó hoạt động để mạnh hơn đáng kể so với testosterone tinh khiết. Nó xấp xỉ 6,6 lần đồng hóa trong khi chỉ 40% là androgenic. Điều này có thể không phải là một so sánh đặc biệt công bằng hoặc hợp lệ tuy nhiên. Sẽ phù hợp hơn khi so sánh norclostebol với [[testosterone propionate]] do sử dụng este. Trong trường hợp này, chúng khá đồng đều về tiềm năng đồng hóa ở mức 112% nhưng chỉ có 20-25% là androgenic. Trong thực tế điều này có nghĩa là norclostebol là một hợp chất đồng hóa mạnh với xu hướng tối thiểu đối với các tác dụng phụ.{{Cần chú thích|date=November 2016}}

==Tham khảo==
{{Tham khảo}}

[[Thể loại:Keton]]
[[Thể loại:Androgen và steroid đồng hóa]]
[[Thể loại:Enone]]
[[Thể loại:Estrane]]
[[Thể loại:Hợp chất chlor hữu cơ]]

Norclostebol - Lịch sử thay đổi

imported>AnsterBot: (Bot) AlphamaEditor, thêm thể loại, Executed time: 00:00:05.2204015