imported>AnsterBot: (Bot) AlphamaEditor, thêm thể loại, Executed time: 00:00:08.5147989

2026-01-14T10:14:22Z

(Bot) AlphamaEditor, thêm thể loại, Executed time: 00:00:08.5147989

Trang mới

{{Infobox drug
| IUPAC_name = [(8''R'',9''S'',10''R'',13''S'',14''S'')-4-Chloro-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-17-yl] acetate
| image = Norclostebol acetate.svg
| width = 250

| tradename = Anabol 4-19
| pregnancy_AU = 
| pregnancy_US = 
| pregnancy_category =
| legal_AU = 
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = [[Intramuscular injection]]

| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion = 
| CAS_number = 1164-99-4
| CAS_number_Ref =
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 101730066
| IUPHAR_ligand =
| DrugBank =
| DrugBank_Ref =
| ChemSpiderID = 91682
| ChemSpiderID_Ref =
| UNII = JKP2S7674A
| KEGG =
| ChEBI =
| ChEMBL = 
| synonyms =
| C = 20
| Cl = 1
| H = 27
| O = 3
| SMILES = CC(=O)OC1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C(C(=O)CC[C@H]34)Cl)C
| StdInChI = 1S/C20H27ClO3/c1-11(22)24-18-8-6-16-14-3-4-15-12(5-7-17(23)19(15)21)13(14)9-10-20(16,18)2/h12-14,16,18H,3-10H2,1-2H3/t12-,13-,14-,16+,18?,20+/m1/s1
| StdInChIKey = FNMAFGQVNCRKGS-FOMDFYGASA-N
| StdInChIKey_Ref =
| StdInChI_Ref =
| verifiedrevid =
}}
'''Norclostebol acetate''' (tên thương hiệu '''Anabol 4-19'''), hoặc '''norchlorotestosterone acetate''' ('''NClTA'''), còn được gọi là '''4-chloro-19-nortestosterone 17β-acetate''' hoặc là '''4-chloroestr-4-en-17β-ol-3-one''', là một [[Steroid đồng hóa-androgenic|steroid đồng hóa]] [[Hợp chất hữu cơ|tổng hợp]], [[Tiêm (thuốc)|tiêm]] [[Steroid đồng hóa-androgenic|androgenic]] (AAS) và dẫn xuất của [[19-nortestosterone]] (nandrolone).<ref name="Elks2014">{{Chú thích sách|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA254|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|last=J. Elks|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=254}}</ref><ref name="Lowinson2005">{{Chú thích sách|url=https://books.google.com/books?id=HtGb2wNsgn4C&pg=PA428|title=Substance Abuse: A Comprehensive Textbook|last=Joyce H. Lowinson|publisher=Lippincott Williams & Wilkins|year=2005|isbn=978-0-7817-3474-5|pages=428–}}</ref><ref name="VaamondePlessis2016">{{Chú thích sách|url=https://books.google.com/books?id=d86zCwAAQBAJ&pg=PA230|title=Exercise and Human Reproduction: Induced Fertility Disorders and Possible Therapies|last=Diana Vaamonde|last2=Stefan S du Plessis|last3=Ashok Agarwal|date=7 March 2016|publisher=Springer|isbn=978-1-4939-3402-7|pages=230–}}</ref><ref name="Van HoofDe Wasch2004">{{Chú thích tạp chí|last=Van Hoof|first=N.|last2=De Wasch|first2=K.|last3=Poelmans|first3=S.|last4=Bruneel|first4=D.|last5=Spruyt|first5=S.|last6=Noppe|first6=H.|last7=Janssen|first7=C.|last8=Courtheyn|first8=D.|last9=De Brab|first9=H.|year=2004|title=Norchlorotestosterone Acetate: An Alternative Metabolism Study and GC?MS2 Analysis in Kidney Fat, Urine, and Faeces|journal=Chromatographia|volume=59|issue=S1|pages=S85–S93|doi=10.1365/s10337-003-0178-4|issn=0009-5893}}</ref><ref name="pmid16216493">{{Chú thích tạp chí|vauthors=Le Bizec B, Van Hoof N, Courtheyn D, Gaudin I, Van De Wiele M, Bichon E, De Brabander H, André F|year=2006|title=New anabolic steroid illegally used in cattle-structure elucidation of 19-norchlorotestosterone acetate metabolites in bovine urine|url=|journal=J. Steroid Biochem. Mol. Biol.|volume=98|issue=1|pages=78–89|doi=10.1016/j.jsbmb.2005.07.008|pmid=16216493}}</ref> Nó là một [[este androgen]] - đặc biệt, các C17β [[axetat]] [[este]]r của [[norclostebol]] (4-chloro-19-nortestosterone).<ref name="Elks2014" /><ref name="Lowinson2005" />

== Xem thêm ==

* [[Clostebol]]
* [[Clostebol axetat]]
* [[Clostebol caproate]]
* [[Clostebol propionate]]
* [[Oxi hóa|Oxabolone]]
* [[Oxipone cipionate]]

==Tham khảo==
{{Tham khảo|30em}}

[

[[Thể loại:Este acetat]]
[[Thể loại:Este androgen]]
[[Thể loại:Estrane]]
[[Thể loại:Hợp chất chlor hữu cơ]]

Norclostebol acetate - Lịch sử thay đổi

imported>AnsterBot: (Bot) AlphamaEditor, thêm thể loại, Executed time: 00:00:08.5147989