<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="vi">
	<id>https://wikibeta.org/index.php?action=history&amp;feed=atom&amp;title=Phenprocoumon</id>
	<title>Phenprocoumon - Lịch sử thay đổi</title>
	<link rel="self" type="application/atom+xml" href="https://wikibeta.org/index.php?action=history&amp;feed=atom&amp;title=Phenprocoumon"/>
	<link rel="alternate" type="text/html" href="https://wikibeta.org/index.php?title=Phenprocoumon&amp;action=history"/>
	<updated>2026-08-11T10:46:54Z</updated>
	<subtitle>Lịch sử thay đổi trang này trên wiki</subtitle>
	<generator>MediaWiki 1.46.0</generator>
	<entry>
		<id>https://wikibeta.org/index.php?title=Phenprocoumon&amp;diff=7101600&amp;oldid=prev</id>
		<title>imported&gt;Tuanminh01: Xoá khỏi Category:Pages with unreviewed translations dùng Cat-a-lot</title>
		<link rel="alternate" type="text/html" href="https://wikibeta.org/index.php?title=Phenprocoumon&amp;diff=7101600&amp;oldid=prev"/>
		<updated>2019-08-16T02:50:46Z</updated>

		<summary type="html">&lt;p&gt;Xoá khỏi &lt;a href=&quot;/wiki/Th%E1%BB%83_lo%E1%BA%A1i:Pages_with_unreviewed_translations&quot; title=&quot;Thể loại:Pages with unreviewed translations&quot;&gt;Category:Pages with unreviewed translations&lt;/a&gt; dùng &lt;a href=&quot;/index.php?title=C:Help:Cat-a-lot&amp;amp;action=edit&amp;amp;redlink=1&quot; class=&quot;new&quot; title=&quot;C:Help:Cat-a-lot (trang không tồn tại)&quot;&gt;Cat-a-lot&lt;/a&gt;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;Trang mới&lt;/b&gt;&lt;/p&gt;&lt;div&gt;{{Infobox drug&lt;br /&gt;
| IUPAC_name = (&amp;#039;&amp;#039;RS&amp;#039;&amp;#039;)-4-hydroxy-3-(1-phenylpropyl)-2&amp;#039;&amp;#039;H&amp;#039;&amp;#039;-chromen-2-one&lt;br /&gt;
| image = Phenprocoumon.svg&lt;br /&gt;
&amp;lt;!--Clinical data--&amp;gt;| tradename = Marcoumar, Marcumar, Falithrom&lt;br /&gt;
| Drugs.com = {{drugs.com|international|phenprocoumon}}&lt;br /&gt;
| MedlinePlus = a699003&lt;br /&gt;
| pregnancy_AU = &amp;lt;!-- A / B1 / B2 / B3 / C / D / X --&amp;gt;&lt;br /&gt;
| pregnancy_US = &amp;lt;!-- A / B / C / D / X --&amp;gt;&lt;br /&gt;
| pregnancy_category = &lt;br /&gt;
| legal_AU = &amp;lt;!-- Unscheduled / S2 / S4 / S8 --&amp;gt;&lt;br /&gt;
| legal_UK = &amp;lt;!-- GSL / P / POM / CD --&amp;gt;&lt;br /&gt;
| legal_US = &amp;lt;!-- OTC / Rx-only --&amp;gt;&lt;br /&gt;
| legal_status = Rx&lt;br /&gt;
| routes_of_administration = &amp;lt;!--Pharmacokinetic data--&amp;gt;&lt;br /&gt;
| bioavailability = &lt;br /&gt;
| protein_bound = 99%&lt;br /&gt;
| metabolism = hepatic to inactive metabolites&lt;br /&gt;
| elimination_half-life = 5 to 6 days&lt;br /&gt;
| excretion = &amp;lt;!--Identifiers--&amp;gt;&lt;br /&gt;
| CAS_number = 435-97-2&lt;br /&gt;
| CAS_number_Ref = {{cascite|correct|??}}&lt;br /&gt;
| ATC_prefix = B01&lt;br /&gt;
| ATC_suffix = AA04&lt;br /&gt;
| ATC_supplemental = &lt;br /&gt;
| PubChem = 9908&lt;br /&gt;
| IUPHAR_ligand = 6839&lt;br /&gt;
| DrugBank = DB00946&lt;br /&gt;
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}&lt;br /&gt;
| ChemSpiderID = 10441592&lt;br /&gt;
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}&lt;br /&gt;
| UNII = Q08SIO485D&lt;br /&gt;
| UNII_Ref = {{fdacite|correct|FDA}}&lt;br /&gt;
| KEGG = D05457&lt;br /&gt;
| KEGG_Ref = {{keggcite|correct|kegg}}&lt;br /&gt;
| ChEBI = 50438&lt;br /&gt;
| ChEBI_Ref = {{ebicite|correct|EBI}}&lt;br /&gt;
| ChEMBL = 1465&lt;br /&gt;
&amp;lt;!--Chemical data--&amp;gt;| ChEMBL_Ref = {{ebicite|correct|EBI}}&lt;br /&gt;
| C = 18&lt;br /&gt;
| H = 16&lt;br /&gt;
| O = 3&lt;br /&gt;
| molecular_weight = 280.318 g/mol&lt;br /&gt;
| SMILES = OC=1c3ccccc3OC(=O)C=1C(CC)c2ccccc2&lt;br /&gt;
| StdInChI = 1S/C18H16O3/c1-2-13(12-8-4-3-5-9-12)16-17(19)14-10-6-7-11-15(14)21-18(16)20/h3-11,13,19H,2H2,1H3&lt;br /&gt;
| StdInChIKey = DQDAYGNAKTZFIW-UHFFFAOYSA-N&lt;br /&gt;
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| verifiedrevid = 464200729&lt;br /&gt;
}} &amp;#039;&amp;#039;&amp;#039;Phenprocoumon&amp;#039;&amp;#039;&amp;#039; (được bán dưới tên thương hiệu &amp;#039;&amp;#039;&amp;#039;Marcoumar&amp;#039;&amp;#039;&amp;#039;, &amp;#039;&amp;#039;&amp;#039;Marcumar&amp;#039;&amp;#039;&amp;#039; và &amp;#039;&amp;#039;&amp;#039;Falithrom)&amp;#039;&amp;#039;&amp;#039; là một loại thuốc [[Thuốc chống đông|chống đông]] đường uống có tác dụng lâu dài, một dẫn xuất của [[coumarin]]. Nó là một chất đối kháng vitamin K ức chế sự đông máu bằng cách ngăn chặn sự tổng hợp các [[Sự đông máu|yếu tố đông máu]] II, VII, IX và X. Nó được sử dụng để [[Y học dự phòng|điều trị dự phòng]] và điều trị rối loạn [[huyết khối]] ([[huyết khối]] / [[Thuyên tắc động mạch phổi|thuyên tắc phổi]]). Nó là coumarin tiêu chuẩn được sử dụng ở Đức.&lt;br /&gt;
&lt;br /&gt;
Phenprocoumon là một 4-hydroxycoumarin và ức chế vitamin K epoxide reductase.&amp;lt;ref&amp;gt;[http://www.pharmgkb.org/drug/PA450921#tabview=tab2&amp;amp;subtab=31 Phenprocoumon] at PharmGKB&amp;lt;/ref&amp;gt;&lt;br /&gt;
&lt;br /&gt;
==Tham khảo==&lt;br /&gt;
{{Tham khảo}}&lt;br /&gt;
&lt;br /&gt;
== Liên kết ngoài ==&lt;br /&gt;
* {{DiseasesDB|29943}}&lt;/div&gt;</summary>
		<author><name>imported&gt;Tuanminh01</name></author>
	</entry>
</feed>