imported>NhacNy2412Bot: sửa tham số CS1

2023-01-01T09:26:10Z

sửa tham số CS1

Trang mới

{{Infobox drug
| drug_name =
| type = 
| IUPAC_name = 2-methyl-3-[(2''E'')-3,7,11,15-tetramethylhexadec-2-en-1-yl]naphthoquinone
| image = Vitamin K1.png
| width =
| alt =
| caption = 
| image2 =
| width2 =
| alt2 =
| imageL =
| widthL =
| altL =
| widthR =
| imageR =
| altR =
| pronounce =
| tradename = Mephyton, others
| Drugs.com = {{Drugs.com|monograph|phytonadione}}
| MedlinePlus =
| licence_EU = 
| licence_US = 
| DailyMedID = 
| pregnancy_AU = 
| pregnancy_AU_comment =
| pregnancy_US = C
| pregnancy_US_comment =
| pregnancy_category =
| legal_AU = 
| legal_AU_comment =
| legal_CA = 
| legal_CA_comment =
| legal_DE = 
| legal_DE_comment =
| legal_NZ = 
| legal_NZ_comment =
| legal_UK = 
| legal_UK_comment =
| legal_US = OTC
| legal_UN = 
| legal_US_comment =
| legal_UN_comment =
| legal_status = 
| dependency_liability =
| addiction_liability =
| routes_of_administration = by mouth, subQ, IM, IV
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion = 
| CAS_number = 84-80-0
| CAS_supplemental = {{cascite|correct|CAS}}
| ATCvet =
| ATC_prefix = B02
| ATC_suffix = BA01
| ATC_supplemental =
| PubChem = 4812
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank = DB01022
| ChemSpiderID = 4447652
| UNII = A034SE7857
| KEGG =
| ChEBI = 18067
| ChEMBL = 1550
| NIAID_ChemDB =
| synonyms = Vitamin K<sub>1</sub>, phytonadione, phylloquinone
| chemical_formula =
| Ag =
| Al =
| As =
| Au =
| B =
| Bi =
| Br =
| C = 31
| Ca =
| Cl =
| Co =
| F =
| Fe =
| Gd =
| H = 46
| I =
| K =
| Li =
| Mg =
| Mn =
| N =
| Na =
| O = 2
| P =
| Pt =
| S =
| Sb =
| Se =
| Sr =
| Tc =
| Zn =
| charge =
| molecular_weight = 450.70 g/mol
| SMILES = CC1=C(C(=O)c2ccccc2C1=O)C/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C
| StdInChI = 1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/b25-20+/t23-,24-/m1/s1
| StdInChIKey = MBWXNTAXLNYFJB-NKFFZRIASA-N
| density =
| density_notes =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
| INN =
| class =
| Jmol =
}}'''Phytomenadione''', còn được gọi là '''vitamin K1''' hoặc '''phylloquinone''', là một loại [[vitamin]] được tìm thấy trong thực phẩm và được sử dụng như một chất bổ sung trong [[chế độ ăn uống]].<ref>{{chú thích sách|last1=Watson|first1=Ronald Ross|title=Diet and Exercise in Cystic Fibrosis|date=2014|publisher=Academic Press|isbn=9780128005880|page=187|url=https://books.google.ca/books?id=hSSOAwAAQBAJ&pg=PA187|language=en|url-status=live|archiveurl=https://web.archive.org/web/20161230000443/https://books.google.ca/books?id=hSSOAwAAQBAJ&pg=PA187|archive-date = ngày 30 tháng 12 năm 2016 |df=}}</ref><ref name="AHFS2016">{{chú thích web|title=Phytonadione|url=https://www.drugs.com/monograph/phytonadione.html|publisher=The American Society of Health-System Pharmacists|access-date =ngày 8 tháng 12 năm 2016|url-status=live|archiveurl=https://web.archive.org/web/20161229172825/https://www.drugs.com/monograph/phytonadione.html|archive-date=ngày 29 tháng 12 năm 2016|df=}}</ref> Chúng có thể được sử dụng để điều trị một số rối loạn chảy máu,<ref name="AHFS2016" /> bao gồm cả [[quá liều warfarin]], [[thiếu hụt vitamin K]] và [[vàng da tắc nghẽn]].<ref name="AHFS2016" /> Chúng cũng được khuyến cáo để phòng ngừa và điều trị bệnh [[xuất huyết]] của [[trẻ sơ sinh]].<ref name="AHFS2016" /> Thuốc thường được khuyến cáo sử dụng qua đường miệng hoặc [[tiêm dưới da]].<ref name="AHFS2016" /> Sử dụng bằng cách [[tiêm vào tĩnh mạch]] hoặc cơ chỉ nên làm khi các tuyến đường khác là không thể.<ref name="AHFS2016" /> Nếu sử dụng bằng cách tiêm thì thuốc sẽ có tác dụng trong vòng hai giờ.<ref name="AHFS2016" />

[[Tác dụng phụ của thuốc|Tác dụng phụ]] thường gặp khi được tiêm bằng cách bao gồm đau tại chỗ tiêm và thay đổi vị giác.<ref name="AHFS2016" /> Các phản ứng [[dị ứng]] nặng có thể xảy ra khi tiêm vào tĩnh mạch hoặc cơ.<ref name="AHFS2016" /> Cũng không rõ ràng về mức độ an toàn nếu sử dụng trong khi [[Thai nghén|mang thai]]; tuy nhiên, việc sử dụng có thể được chấp nhận trong thời gian [[Nuôi con bằng sữa mẹ|cho con bú]].<ref>{{chú thích web|title=Phytonadione Use During Pregnancy|url=https://www.drugs.com/pregnancy/phytonadione.html|website=Drugs.com|access-date =ngày 29 tháng 12 năm 2016|url-status=live|archiveurl=https://web.archive.org/web/20161229172908/https://www.drugs.com/pregnancy/phytonadione.html|archive-date=ngày 29 tháng 12 năm 2016|df=}}</ref> Chúng hoạt động bằng cách cung cấp một thành phần cần thiết để tạo ra một số [[yếu tố đông máu]].<ref name="AHFS2016" /> Phytomenadione có thể được tìm thấy trong rau xanh, [[dầu thực vật]] và một số [[Quả|trái cây]].<ref name="NIH2016">{{chú thích web|title=Office of Dietary Supplements – Vitamin K|url=https://ods.od.nih.gov/factsheets/VitaminK-HealthProfessional|website=ods.od.nih.gov|access-date =ngày 30 tháng 12 năm 2016|date=ngày 11 tháng 2 năm 2016|url-status=live|archiveurl=https://web.archive.org/web/20161231075317/https://ods.od.nih.gov/factsheets/VitaminK-HealthProfessional/|archive-date=ngày 31 tháng 12 năm 2016|df=}}</ref>

Phytomenadione lần đầu tiên được phân lập vào năm 1939.<ref name="Sn2005">{{chú thích sách|last1=Sneader|first1=Walter|title=Drug Discovery: A History|date=2005|publisher=John Wiley & Sons|isbn=9780471899792|page=243|url=https://books.google.ca/books?id=Cb6BOkj9fK4C&pg=PA243|language=en|url-status=live|archiveurl=https://web.archive.org/web/20161230000050/https://books.google.ca/books?id=Cb6BOkj9fK4C&pg=PA243|archive-date = ngày 30 tháng 12 năm 2016 |df=}}</ref> Nó nằm trong [[Danh sách các thuốc thiết yếu của WHO|danh sách các thuốc thiết yếu của Tổ chức Y tế Thế giới]], tức là nhóm các loại thuốc hiệu quả và an toàn nhất cần thiết trong một [[hệ thống y tế]].<ref name="WHO19th">{{chú thích web|title=WHO Model List of Essential Medicines (19th List)|url=http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|work=World Health Organization|access-date =ngày 8 tháng 12 năm 2016|date=April 2015|url-status=live|archiveurl=https://web.archive.org/web/20161213052708/http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|archive-date=ngày 13 tháng 12 năm 2016|df=}}</ref> Chi phí bán buôn ở các [[nước đang phát triển]] là khoảng 0,11 đến 1,27 USD cho một lọ 10 mg.<ref name="ERC2014">{{chú thích web|title=Vitamin K1|url=http://mshpriceguide.org/en/single-drug-information/?DMFId=839&searchYear=2014|website=International Drug Price Indicator Guide|access-date =ngày 8 tháng 12 năm 2016|url-status=live|archiveurl=https://web.archive.org/web/20170510104945/http://mshpriceguide.org/en/single-drug-information/?DMFId=839&searchYear=2014|archive-date=ngày 10 tháng 5 năm 2017|df=}}</ref> Tại Hoa Kỳ một đợt điều trị có giá dưới 25 USD.<ref name="Ric2015">{{chú thích sách|last1=Hamilton|first1=Richart|title=Tarascon Pocket Pharmacopoeia 2015 Deluxe Lab-Coat Edition|date=2015|publisher=Jones & Bartlett Learning|isbn=9781284057560|page=229}}</ref> Năm 1943, [[Edward Doisy]] và [[Henrik Dam]] được trao giải [[Nobel y học|Nobel]] nhờ khám phá ra chất này.<ref name="NIH2016" />

== Chú thích ==
{{tham khảo}}

[[Thể loại:Thuốc thiết yếu của WHO]]
[[Thể loại:Thuốc chống đông máu]]

Phytomenadione - Lịch sử thay đổi

imported>NhacNy2412Bot: sửa tham số CS1