https://wikibeta.org/index.php?action=history&feed=atom&title=PirbuterolPirbuterol - Lịch sử thay đổi2026-08-10T11:04:45ZLịch sử thay đổi trang này trên wikiMediaWiki 1.46.0https://wikibeta.org/index.php?title=Pirbuterol&diff=7140047&oldid=previmported>Keo010122Bot: clean up, general fixes using AWB2021-11-12T12:50:29Z<p>clean up, general fixes using <a href="/wiki/Wikipedia:AWB" class="mw-redirect" title="Wikipedia:AWB">AWB</a></p>
<p><b>Trang mới</b></p><div>{{Infobox drug<br />
| IUPAC_name = (''RS'')-6-[2-(''tert''-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)pyridin-3-ol<br />
| image = Pirbuterol.svg<br />
| width = 240<br />
| tradename = Maxair<br />
| Drugs.com = {{drugs.com|CDI|pirbuterol}}<br />
| MedlinePlus = a601096<br />
| pregnancy_category = C<br />
| legal_US = Rx-only<br />
| routes_of_administration = Inhalational ([[Metered-dose inhaler|MDI]])<br />
<br />
<!--Identifiers-->| CAS_number = 38029-10-6<br />
| CAS_number_Ref = {{cascite|changed|??}}<br />
| ATC_prefix = R03<br />
| ATC_suffix = AC08<br />
| ATC_supplemental = {{ATC|R03|CC07}}<br />
| PubChem = 4845<br />
| IUPHAR_ligand = 7272<br />
| DrugBank = DB01291<br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| ChemSpiderID = 4679<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| UNII = OG645J8RVW<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| KEGG = D08387<br />
| KEGG_Ref = {{keggcite|changed|kegg}}<br />
| ChEMBL = 1094966<br />
<br />
<!--Chemical data-->| ChEMBL_Ref = {{ebicite|correct|EBI}}<br />
| C = 12<br />
| H = 20<br />
| N = 2<br />
| O = 3<br />
| molecular_weight = 240.30 g/mol<br>300.3 g/mol (acetate)<br />
| SMILES = Oc1ccc(nc1CO)C(O)CNC(C)(C)C<br />
| StdInChI = 1S/C12H20N2O3/c1-12(2,3)13-6-11(17)8-4-5-10(16)9(7-15)14-8/h4-5,11,13,15-17H,6-7H2,1-3H3<br />
| StdInChIKey = VQDBNKDJNJQRDG-UHFFFAOYSA-N<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| verifiedrevid = 464207791<br />
}}<br />
'''Pirbuterol''' (tên thương mại '''Maxair)''' là một [[Thuốc chủ vận Beta2-adrenergic|chất đồng vận β<sub>2</sub> adrenoreceptor]] tác dụng ngắn với việc [[Thuốc giãn phế quản|giãn phế quản]] sử dụng trong điều trị [[Hen phế quản|hen suyễn]], có sẵn (như pirbuterol acetate) như là một hơi thở kích hoạt [[Thuốc hít đồng hồ đo liều|hít có định liều]].<br />
<br />
Nó được cấp bằng sáng chế vào năm 1971 và được đưa vào sử dụng y tế vào năm 1983.<ref name="Fis2006">{{Chú thích sách|url=https://books.google.ca/books?id=FjKfqkaKkAAC&pg=PA543|title=Analogue-based Drug Discovery|last=Fischer|first=Jnos|last2=Ganellin|first2=C. Robin|date=2006|publisher=John Wiley & Sons|isbn=9783527607495|page=543|language=en}}</ref><br />
<br />
== Sử dụng y tế ==<br />
Pirbuterol được sử dụng trong hen suyễn để đảo ngược [[co thắt phế quản]] cấp tính, và cũng như một loại thuốc duy trì để ngăn chặn các cuộc tấn công trong tương lai. Nó nên được sử dụng ở những bệnh nhân từ 12 tuổi trở lên có hoặc không kèm theo [[theophylline]] và/hoặc hít [[corticosteroid]].<ref name="PI">{{Chú thích web|url=http://solutions.3m.com/3MContentRetrievalAPI/BlobServlet?lmd=1137774415000&locale=en_US&univid=1114282316409&fallback=true&assetType=MMM_Image&blobAttribute=ImageFile&placeId=39903&version=current|title=Maxair Autohaler (pirbuterol acetate inhalation aerosol) For Oral Inhalation Only. U.S. Full Prescribing Information|publisher=3M Pharmaceuticals. Northridge, CA 91324|access-date =ngày 7 tháng 3 năm 2016|archive-date = ngày 20 tháng 9 năm 2018 |archive-url=https://web.archive.org/web/20180920082834/http://solutions.3m.com/3MContentRetrievalAPI/BlobServlet?lmd=1137774415000&locale=en_US&univid=1114282316409&fallback=true&assetType=MMM_Image&blobAttribute=ImageFile&placeId=39903&version=current}}</ref><ref name="BianchiClavenna2010">{{Chú thích tạp chí|last=Bianchi|first=Marina|last2=Clavenna|first2=Antonio|last3=Bonati|first3=Maurizio|year=2010|title=Inter-country variations in anti-asthmatic drug prescriptions for children. Systematic review of studies published during the 2000–2009 period|url=https://hal.archives-ouvertes.fr/hal-00599220/file/PEER_stage2_10.1007%252Fs00228-010-0845-y.pdf|journal=European Journal of Clinical Pharmacology|volume=66|issue=9|pages=929–936|doi=10.1007/s00228-010-0845-y|issn=0031-6970}}</ref><br />
<br />
== Phương thức hành động ==<br />
<br />
== Dược động học ==<br />
Sau khi hít liều tới 800 [[Micrôgam|''μ'' g]] (gấp đôi liều khuyến cáo tối đa) nồng độ pirbuterol trong máu dưới mức giới hạn của độ nhạy của xét nghiệm (2 &nbsp; ng / ml). Một trung bình 51% liều được thu hồi trong nước tiểu dưới dạng pirbuterol cộng với liên hợp sulfate của nó sau khi dùng bằng khí dung. Pirbuterol không được chuyển hóa bởi [[Catechol-O-methyl transferase|catechol- ''O'' -methyltransferase]]. Thời gian bán hủy trong huyết tương đo được sau khi uống khoảng hai giờ.<ref name="PI"/><br />
<br />
== Tác dụng phụ ==<br />
<br />
== Tham khảo ==<br />
{{Tham khảo}}<br />
<br />
== Liên kết ngoài ==<br />
<br />
* [http://www.rxlist.com/cgi/generic/pirbu.htm RxList: Maxair (Pirbuterol)] {{Webarchive|url=https://web.archive.org/web/20080706183351/http://www.rxlist.com/cgi/generic/pirbu.htm |date = ngày 6 tháng 7 năm 2008}}</div>imported>Keo010122Bot