-3-methoxybenzamide

Satavaptan
Các định danh
Tên IUPAC
  • N-(tert-butyl)-4-{[(1s,4s)-5'-ethoxy-4-(2-morpholin-4-ylethoxy)-2'-oxospiro[cyclohexane-1,3'-indol]-1'(2'H)-yl]sulfonyl
Số E{{#property:P628}}
ECHA InfoCard{{#property:P2566}}

| image = Satavaptan structure.svg | width = 200 | tradename = | legal_status = | routes_of_administration = | CAS_number = 185913-78-4 | CAS_number_Ref =  checkY | ATC_prefix = none | PubChem = 9810773 | DrugBank_Ref =  checkY | ChemSpiderID = 32699105 | ChemSpiderID_Ref =  KhôngN | UNII = AJS8S3P31H | UNII_Ref =  checkY | C = 33 | H = 45 | N = 3 | O = 8 | S = 1 | molecular_weight = 643.789 g/mol | SMILES = C1COCCN1CCO[C@H]2CC[C@](CC2)3c4cc(OCC)ccc4N(C3=O)S(=O)(=O)c5ccc(cc5OC)C(=O)NC(C)(C)C | StdInChI = 1S/C33H45N3O8S/c1-6-43-25-8-9-27-26(22-25)33(13-11-24(12-14-33)44-20-17-35-15-18-42-19-16-35)31(38)36(27)45(39,40)29-10-7-23(21-28(29)41-5)30(37)34-32(2,3)4/h7-10,21-22,24H,6,11-20H2,1-5H3,(H,34,37)/t24-,33+ | StdInChIKey = QKXJWFOKVQWEDZ-VCCCEUOBSA-N | StdInChIKey_Ref =  KhôngN | StdInChI_Ref =  KhôngN | verifiedrevid = 455169440 }} Satavaptan (INN; tên mã phát triển SR121463, tên thương hiệu dự kiến trước đây là Aquilda) là một chất đối vận thụ thể vasopressin-2 [1] được điều tra bởi Sanofi-Aventis và đang được phát triển để điều trị hạ natri máu. Nó cũng đã được nghiên cứu để điều trị cổ trướng.[2] Thuốc đã bị ngừng phát triển vào năm 2009.[3]

Tham khảo

  1. ^ Soupart A; Gross P; Legros JJ; và đồng nghiệp (tháng 11 năm 2006). "Successful long-term treatment of hyponatremia in syndrome of inappropriate antidiuretic hormone secretion with satavaptan (SR121463B), an orally active nonpeptide vasopressin V2-receptor antagonist". Clin J Am Soc Nephrol. Quyển 1 số 6. tr. 1154–1160. doi:10.2215/CJN.00160106. PMID 17699341.
  2. ^ Ginès P; Wong F; Watson H; Milutinovic S; Ruiz Del Arbol L; Olteanu D (tháng 2 năm 2008). "Effects of satavaptan, a selective vasopressin V(2) receptor antagonist, on ascites and serum sodium in cirrhosis with hyponatremia: A randomized trial". Hepatology. Quyển 48 số 1. tr. 204–213. doi:10.1002/hep.22293. PMID 18508290.
  3. ^ http://adisinsight.springer.com/drugs/800007591